cas: 1257651-13-0 — see every product listed under this CAS number, including other names
1H-Benzo[d][1,2,3]triazole-6-boronic Acid Pinacol Ester, >97%, >97% (CAS 1257651-13-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ONJ-250mg |
| cas | 1257651-13-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 602.00 Pln | |
| Chemat | 1g | 1518.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole (CAS 1257651-13-0) is a chemical compound with the molecular formula C12H16BN3O2 and a molecular weight of 245.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole. InChIKey: QUYDCPHDUNQFKF-UHFFFAOYSA-N.
| Molecular formula | C12H16BN3O2 |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole |
| InChIKey | QUYDCPHDUNQFKF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NNN=C3C=C2 |
Computed by PubChem (NCBI)