Products 944401-73-4
CAS 944401-73-4 is the registry number for 2-Amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isonicotinonitrile, 98+%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbonitrile (CAS 944401-73-4) is a chemical compound with the molecular formula C12H16BN3O2 and a molecular weight of 245.09 g/mol. IUPAC name: 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbonitrile. InChIKey: ILFHCZIKOMNCGU-UHFFFAOYSA-N.
| Molecular formula | C12H16BN3O2 |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-4-carbonitrile |
| InChIKey | ILFHCZIKOMNCGU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2C#N)N |
Computed by PubChem (NCBI)