cas: 65558-69-2 — see every product listed under this CAS number, including other names
1H-Benzo[f]isoindole-1,3(2H)-diimine, 95%, 95% (CAS 65558-69-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 200mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DJZ-100mg |
| cas | 65558-69-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 200mg | 290.00 Pln | |
| Chemat | 1g | 765.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-iminobenzo[f]isoindol-1-amine (CAS 65558-69-2) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 3-iminobenzo[f]isoindol-1-amine. InChIKey: JAWNWEKHDFBPSG-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 3-iminobenzo[f]isoindol-1-amine |
| InChIKey | JAWNWEKHDFBPSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C(=NC3=N)N |
Computed by PubChem (NCBI)