1H-INDAZOLE-7-CARBOXYLIC ACID, 98%, 98%
cas: 677304-69-7 — see every product listed under this CAS number, including other names
1H-INDAZOLE-7-CARBOXYLIC ACID, 98%, 98% (CAS 677304-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147TU-1g |
| cas | 677304-69-7 |
| size | 1g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 50g | 381.20 Pln | |
| Chemat | 100g | 683.60 Pln | |
| Chemat | 250g | 1542.80 Pln | |
| Chemat | 1kg | 2090.00 Pln | |
| Chemat | 5kg | 10800.00 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1H-indazole-7-carboxylic acid (CAS 677304-69-7) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-7-carboxylic acid. InChIKey: WBCWIQCXHSXMDH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-7-carboxylic acid |
| InChIKey | WBCWIQCXHSXMDH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NN=C2 |
Computed by PubChem (NCBI)