cas: 1086392-18-8 — see every product listed under this CAS number, including other names
1H-Indazole-6-carbohydrazide, 98%, 98% (CAS 1086392-18-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103DK-250mg |
| cas | 1086392-18-8 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 760.40 Pln | |
| Chemat | 5g | 2738.00 Pln | |
| Chemat | 25g | 4533.20 Pln | |
| Chemat | 10g | 3645.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1H-indazole-6-carbohydrazide (CAS 1086392-18-8) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 1H-indazole-6-carbohydrazide. InChIKey: KENXPCFIMIWOSV-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 1H-indazole-6-carbohydrazide |
| InChIKey | KENXPCFIMIWOSV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)NN)NN=C2 |
Computed by PubChem (NCBI)