CAS 1937280-83-5 is the registry number for 6-(Hydroxyimino)methyl]-1H-indazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(NE)-N-[(3-amino-1H-indazol-6-yl)methylidene]hydroxylamine (CAS 1937280-83-5) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: (NE)-N-[(3-amino-1H-indazol-6-yl)methylidene]hydroxylamine. InChIKey: RYRWBHPKEJATDA-ONNFQVAWSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | (NE)-N-[(3-amino-1H-indazol-6-yl)methylidene]hydroxylamine |
| InChIKey | RYRWBHPKEJATDA-ONNFQVAWSA-N |
| SMILES | C1=CC2=C(C=C1/C=N/O)NN=C2N |
Computed by PubChem (NCBI)