CAS 915921-91-4 appears in our catalog under these names: [3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl]methanamine dihydrochloride, 95%, (3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl)methanamine, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, 10g, on request.
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methanamine (CAS 915921-91-4) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methanamine. InChIKey: YMSAQOZOTRIKJQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methanamine |
| InChIKey | YMSAQOZOTRIKJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NOC(=N2)CN |
Computed by PubChem (NCBI)