1H-Indazole-6-sulfonyl chloride 95%
cas: 131290-01-2 — see every product listed under this CAS number, including other names
1H-Indazole-6-sulfonyl chloride 95% (CAS 131290-01-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A234051-50mg |
| cas | 131290-01-2 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 659.62 Pln | |
| Ambeed | 100mg | 876.56 Pln | |
| Ambeed | 250mg | 1566.31 Pln | |
| Ambeed | 1g | 4097.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A234051 |
1H-indazole-6-sulfonyl chloride (CAS 131290-01-2) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 1H-indazole-6-sulfonyl chloride. InChIKey: DFUDXPXXTZSCSN-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 1H-indazole-6-sulfonyl chloride |
| InChIKey | DFUDXPXXTZSCSN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)NN=C2 |
Computed by PubChem (NCBI)