CAS 1001412-59-4 appears in our catalog under these names: 1H-Pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 95%, 1H-Pyrrolo(2,3-b)pyridine-3-sulfonyl chloride, 98%, 1H-Pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 95%, 95%, 1H-Pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride (CAS 1001412-59-4) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride. InChIKey: CNZIHLRMHLLIJQ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride |
| InChIKey | CNZIHLRMHLLIJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC=C2S(=O)(=O)Cl)N=C1 |
Computed by PubChem (NCBI)