CAS 131290-01-2 appears in our catalog under these names: 1H-Indazole-6-sulfonyl chloride, 95%, 1H-Indazole-6-sulfonyl chloride 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
1H-indazole-6-sulfonyl chloride (CAS 131290-01-2) is a chemical compound with the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. IUPAC name: 1H-indazole-6-sulfonyl chloride. InChIKey: DFUDXPXXTZSCSN-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2S |
|---|---|
| Molecular weight | 216.65 g/mol |
| IUPAC name | 1H-indazole-6-sulfonyl chloride |
| InChIKey | DFUDXPXXTZSCSN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)NN=C2 |
Computed by PubChem (NCBI)