cas: 312746-74-0 — see every product listed under this CAS number, including other names
1H-Indazole-7-carboxamide, 97%, 97% (CAS 312746-74-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118I2K-50mg |
| cas | 312746-74-0 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 117.20 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1418.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1H-indazole-7-carboxamide (CAS 312746-74-0) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 1H-indazole-7-carboxamide. InChIKey: ZWZKHJQCLZIUIT-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 1H-indazole-7-carboxamide |
| InChIKey | ZWZKHJQCLZIUIT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)N)NN=C2 |
Computed by PubChem (NCBI)