cas: 312746-74-0 — see every product listed under this CAS number, including other names
1H-Indazole-7-carboxamide, 98% (CAS 312746-74-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 250mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-4173-5g |
| cas | 312746-74-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 10g | 2262.76 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 10g | 2262.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1H-indazole-7-carboxamide (CAS 312746-74-0) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 1H-indazole-7-carboxamide. InChIKey: ZWZKHJQCLZIUIT-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 1H-indazole-7-carboxamide |
| InChIKey | ZWZKHJQCLZIUIT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)N)NN=C2 |
Computed by PubChem (NCBI)