cas: 1257535-37-7 — see every product listed under this CAS number, including other names
1H-Indazole-7-carboxylic acid, 3-bromo-, methyl ester, 95%, 95% (CAS 1257535-37-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FGHA-100mg |
| cas | 1257535-37-7 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 837.20 Pln | |
| Chemat | 10g | 1475.60 Pln | |
| Chemat | 25g | 2891.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-2H-indazole-7-carboxylate (CAS 1257535-37-7) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 3-bromo-2H-indazole-7-carboxylate. InChIKey: TZGIJSHGAUIOST-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 3-bromo-2H-indazole-7-carboxylate |
| InChIKey | TZGIJSHGAUIOST-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C(NN=C21)Br |
Computed by PubChem (NCBI)