Products 195986-74-4
CAS 195986-74-4 appears in our catalog under these names: 7-Bromo-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 98%, 7-Bromo-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 97%, 97%, 7-Bromo-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (CAS 195986-74-4) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione. InChIKey: QTLHJODGGBYWLC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| InChIKey | QTLHJODGGBYWLC-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Br)C(=O)N1 |
Computed by PubChem (NCBI)