cas: 110811-31-9 — see every product listed under this CAS number, including other names
1H-Indole-3-carboxylic acid, 4-bromo-, 98%, 98% (CAS 110811-31-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118C3Y-100mg |
| cas | 110811-31-9 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1514.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1H-indole-3-carboxylic acid (CAS 110811-31-9) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 4-bromo-1H-indole-3-carboxylic acid. InChIKey: GJQQLCJFHKJARJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 4-bromo-1H-indole-3-carboxylic acid |
| InChIKey | GJQQLCJFHKJARJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)