CAS 110811-31-9 appears in our catalog under these names: 4-Bromo-1h-indole-3-carboxylic acid, 95%, 4-Bromo-1H-indole-3-carboxylic acid, 4-Bromoindole-3-carboxylic Acid 98%, 1H-Indole-3-carboxylic acid, 4-bromo-, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 2,5g, 100mg.
4-bromo-1H-indole-3-carboxylic acid (CAS 110811-31-9) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 4-bromo-1H-indole-3-carboxylic acid. InChIKey: GJQQLCJFHKJARJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 4-bromo-1H-indole-3-carboxylic acid |
| InChIKey | GJQQLCJFHKJARJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)