Products 28737-33-9
CAS 28737-33-9 appears in our catalog under these names: 3-Bromoindole-2-carboxylic acid, 98%, 3–Bromoindole–2–carboxylic Acid, 3-Bromoindole-2-Carboxylic Acid, 97%, 97%, 3-Bromoindole-2-carboxylic Acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 25g, 100mg, 250mg.
3-bromo-1H-indole-2-carboxylic acid (CAS 28737-33-9) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 3-bromo-1H-indole-2-carboxylic acid. InChIKey: KOTZNHLNBDTYMS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 3-bromo-1H-indole-2-carboxylic acid |
| InChIKey | KOTZNHLNBDTYMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)Br |
Computed by PubChem (NCBI)