cas: 24566-80-1 — see every product listed under this CAS number, including other names
1H-Isoindole-1,3(2H)-dione, 2-(10-bromodecyl)-, 98%, 98% (CAS 24566-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113OK8-100mg |
| cas | 24566-80-1 |
| size | 100mg |
| availability | 41.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 467.60 Pln | |
| Chemat | 10g | 818.00 Pln | |
| Chemat | 25g | 1710.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(10-bromodecyl)isoindole-1,3-dione (CAS 24566-80-1) is a chemical compound with the molecular formula C18H24BrNO2 and a molecular weight of 366.3 g/mol. IUPAC name: 2-(10-bromodecyl)isoindole-1,3-dione. InChIKey: LJFIOTMXPRSHSB-UHFFFAOYSA-N.
| Molecular formula | C18H24BrNO2 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 2-(10-bromodecyl)isoindole-1,3-dione |
| InChIKey | LJFIOTMXPRSHSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCCCCCCBr |
Computed by PubChem (NCBI)