CAS 1160247-40-4 appears in our catalog under these names: tert-Butyl 5-bromo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 95%, tert-Butyl 5-bromo-2,3-dihydrospiro(indene-1,4'-piperidine)-1'-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 6-bromospiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate (CAS 1160247-40-4) is a chemical compound with the molecular formula C18H24BrNO2 and a molecular weight of 366.3 g/mol. IUPAC name: tert-butyl 6-bromospiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate. InChIKey: HPPMHQKNSCAUDK-UHFFFAOYSA-N.
| Molecular formula | C18H24BrNO2 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | tert-butyl 6-bromospiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate |
| InChIKey | HPPMHQKNSCAUDK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC3=C2C=CC(=C3)Br)CC1 |
Computed by PubChem (NCBI)