cas: 24566-80-1 — see every product listed under this CAS number, including other names
2-(10-Bromodecyl)isoindoline-1,3-dione 97% (CAS 24566-80-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A804326-250mg |
| cas | 24566-80-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 25g | 2189.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A804326 |
2-(10-bromodecyl)isoindole-1,3-dione (CAS 24566-80-1) is a chemical compound with the molecular formula C18H24BrNO2 and a molecular weight of 366.3 g/mol. IUPAC name: 2-(10-bromodecyl)isoindole-1,3-dione. InChIKey: LJFIOTMXPRSHSB-UHFFFAOYSA-N.
| Molecular formula | C18H24BrNO2 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 2-(10-bromodecyl)isoindole-1,3-dione |
| InChIKey | LJFIOTMXPRSHSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCCCCCCBr |
Computed by PubChem (NCBI)