cas: 59694-23-4 — see every product listed under this CAS number, including other names
1H-Pyrazole-3,5-dicarboxylic acid, 4-nitro-, 3,5-dimethyl ester, 97%, 97% (CAS 59694-23-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IALE-100mg |
| cas | 59694-23-4 |
| size | 100mg |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1557.20 Pln | |
| Chemat | 10g | 2805.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate (CAS 59694-23-4) is a chemical compound with the molecular formula C7H7N3O6 and a molecular weight of 229.15 g/mol. IUPAC name: dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate. InChIKey: RRANRLASTUBGSJ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O6 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate |
| InChIKey | RRANRLASTUBGSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NN1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)