cas: 59694-23-4 — see every product listed under this CAS number, including other names
Dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate, 98% (CAS 59694-23-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614169-250MG |
| cas | 59694-23-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 502.97 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate (CAS 59694-23-4) is a chemical compound with the molecular formula C7H7N3O6 and a molecular weight of 229.15 g/mol. IUPAC name: dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate. InChIKey: RRANRLASTUBGSJ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O6 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | dimethyl 4-nitro-1H-pyrazole-3,5-dicarboxylate |
| InChIKey | RRANRLASTUBGSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NN1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)