cas: 916850-80-1 — see every product listed under this CAS number, including other names
1H-Pyrazole-4-carboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-1-methyl-, 95%, 95% (CAS 916850-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KFUP-100mg |
| cas | 916850-80-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-4-carboxylic acid (CAS 916850-80-1) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 1-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-4-carboxylic acid. InChIKey: QGGMHAWQLPZVEJ-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-4-carboxylic acid |
| InChIKey | QGGMHAWQLPZVEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=NN1C)C(=O)O |
Computed by PubChem (NCBI)