cas: 2379-60-4 — see every product listed under this CAS number, including other names
2 3-Dichloro-6-nitroquinoxaline 98% (CAS 2379-60-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A569562-250mg |
| cas | 2379-60-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A569562 |
2,3-dichloro-6-nitroquinoxaline (CAS 2379-60-4) is a chemical compound with the molecular formula C8H3Cl2N3O2 and a molecular weight of 244.03 g/mol. IUPAC name: 2,3-dichloro-6-nitroquinoxaline. InChIKey: SFJCUOAQTGDBPO-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2N3O2 |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 2,3-dichloro-6-nitroquinoxaline |
| InChIKey | SFJCUOAQTGDBPO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)