cas: 2379-60-4 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-nitroquinoxaline, 95% (CAS 2379-60-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049489-1G |
| cas | 2379-60-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 315.53 Pln | |
| Fluorochem | 10g | 565.44 Pln | |
| Fluorochem | 25g | 1325.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,3-dichloro-6-nitroquinoxaline (CAS 2379-60-4) is a chemical compound with the molecular formula C8H3Cl2N3O2 and a molecular weight of 244.03 g/mol. IUPAC name: 2,3-dichloro-6-nitroquinoxaline. InChIKey: SFJCUOAQTGDBPO-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2N3O2 |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 2,3-dichloro-6-nitroquinoxaline |
| InChIKey | SFJCUOAQTGDBPO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)