CAS 1366050-48-7 is the registry number for 2,8-dichloro-7-nitro-1,5-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,8-dichloro-7-nitro-1,5-naphthyridine (CAS 1366050-48-7) is a chemical compound with the molecular formula C8H3Cl2N3O2 and a molecular weight of 244.03 g/mol. IUPAC name: 2,8-dichloro-7-nitro-1,5-naphthyridine. InChIKey: GECCKOMBWFQPNY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2N3O2 |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 2,8-dichloro-7-nitro-1,5-naphthyridine |
| InChIKey | GECCKOMBWFQPNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C(C(=CN=C21)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)