cas: 2041-37-4 — see every product listed under this CAS number, including other names
2',2,2-Trimethylpropiophenone, 95% (CAS 2041-37-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A459444-250mg |
| cas | 2041-37-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 349.93 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dimethyl-1-(2-methylphenyl)propan-1-one (CAS 2041-37-4) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 2,2-dimethyl-1-(2-methylphenyl)propan-1-one. InChIKey: AWNJETOROKEWCH-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 2,2-dimethyl-1-(2-methylphenyl)propan-1-one |
| InChIKey | AWNJETOROKEWCH-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)C(C)(C)C |
Computed by PubChem (NCBI)