cas: 3832-55-1 — see every product listed under this CAS number, including other names
2'-(Trifluoromethoxy)acetanilide (CAS 3832-55-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007529-1G |
| cas | 3832-55-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 331.15 Pln |
| delivery time | 2-3 weeks |
|---|
N-[2-(trifluoromethoxy)phenyl]acetamide (CAS 3832-55-1) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: N-[2-(trifluoromethoxy)phenyl]acetamide. InChIKey: KZBHIVIJYKKLHL-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | N-[2-(trifluoromethoxy)phenyl]acetamide |
| InChIKey | KZBHIVIJYKKLHL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1OC(F)(F)F |
Computed by PubChem (NCBI)