cas: 92821-83-5 — see every product listed under this CAS number, including other names
2'-Bromo-3-fluoropropiophenone, 98%, 98% (CAS 92821-83-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GUR0-250mg |
| cas | 92821-83-5 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1686.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-(3-fluorophenyl)propan-1-one (CAS 92821-83-5) is a chemical compound with the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. IUPAC name: 2-bromo-1-(3-fluorophenyl)propan-1-one. InChIKey: FUWLUTOKEUZKCM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 2-bromo-1-(3-fluorophenyl)propan-1-one |
| InChIKey | FUWLUTOKEUZKCM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)F)Br |
Computed by PubChem (NCBI)