CAS 746638-33-5 appears in our catalog under these names: 8-Bromo-6-fluorochroman, 95%, 8–Bromo–6–fluorochroman, 8-Bromo-6-fluorochroman, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
8-bromo-6-fluoro-3,4-dihydro-2H-chromene (CAS 746638-33-5) is a chemical compound with the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. IUPAC name: 8-bromo-6-fluoro-3,4-dihydro-2H-chromene. InChIKey: CWHBRNOMRBEAOU-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 8-bromo-6-fluoro-3,4-dihydro-2H-chromene |
| InChIKey | CWHBRNOMRBEAOU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)F)Br)OC1 |
Computed by PubChem (NCBI)