Products 891844-09-0
CAS 891844-09-0 appears in our catalog under these names: 3-Bromo-5-ethyl-2-fluorobenzaldehyde, 95%, 3-Bromo-5-ethyl-2-fluorobenzaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
3-bromo-5-ethyl-2-fluorobenzaldehyde (CAS 891844-09-0) is a chemical compound with the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. IUPAC name: 3-bromo-5-ethyl-2-fluorobenzaldehyde. InChIKey: KBMGKCHCYMBTMA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 3-bromo-5-ethyl-2-fluorobenzaldehyde |
| InChIKey | KBMGKCHCYMBTMA-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)Br)F)C=O |
Computed by PubChem (NCBI)