cas: 421553-62-0 — see every product listed under this CAS number, including other names
2'-Methoxy-biphenyl-4-carbaldehyde, 97%, 97% (CAS 421553-62-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXMA-250mg |
| cas | 421553-62-0 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 798.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(2-methoxyphenyl)benzaldehyde (CAS 421553-62-0) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 4-(2-methoxyphenyl)benzaldehyde. InChIKey: CFGCKFDEJVKBCY-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4-(2-methoxyphenyl)benzaldehyde |
| InChIKey | CFGCKFDEJVKBCY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)