cas: 400745-54-2 — see every product listed under this CAS number, including other names
2'-Methyl-[1,1'-biphenyl]-3-amine, >97%, >97% (CAS 400745-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 10g, 25g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IUB-100mg |
| cas | 400745-54-2 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 5g | 774.80 Pln | |
| Chemat | 10g | 1216.40 Pln | |
| Chemat | 25g | 2368.40 Pln | |
| Chemat | 1g | 246.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
3-(2-methylphenyl)aniline (CAS 400745-54-2) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 3-(2-methylphenyl)aniline. InChIKey: VSKSSQACZWHPED-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 3-(2-methylphenyl)aniline |
| InChIKey | VSKSSQACZWHPED-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)