CAS 878671-94-4 appears in our catalog under these names: 4–Cyclopropylnaphthalen–1–amine, 4-Cyclopropylnaphthalen-1-amine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
4-cyclopropylnaphthalen-1-amine (CAS 878671-94-4) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 4-cyclopropylnaphthalen-1-amine. InChIKey: NYKSBMRQNSCVMO-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 4-cyclopropylnaphthalen-1-amine |
| InChIKey | NYKSBMRQNSCVMO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N |
Computed by PubChem (NCBI)