CAS 54147-94-3 appears in our catalog under these names: 5-Methyl-2-phenylaniline, 95%, 5-Methyl-2-phenylaniline. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-methyl-2-phenylaniline (CAS 54147-94-3) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 5-methyl-2-phenylaniline. InChIKey: QNWKYDCMXQSXQB-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 5-methyl-2-phenylaniline |
| InChIKey | QNWKYDCMXQSXQB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)