CAS 168618-44-8 appears in our catalog under these names: 2'–Methylbiphenyl–3–carboxylic acid, 2'-Methyl-[1,1'-biphenyl]-3-carboxylic acid, 98%, 98%, 2'-Methylbiphenyl-3-carboxylic acid, 98%, 2'-Methyl-[1,1'-biphenyl]-3-carboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg.
3-(2-methylphenyl)benzoic acid (CAS 168618-44-8) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 3-(2-methylphenyl)benzoic acid. InChIKey: IAZJDWZUCUHVPQ-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3-(2-methylphenyl)benzoic acid |
| InChIKey | IAZJDWZUCUHVPQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)