cas: 4482-03-5 — see every product listed under this CAS number, including other names
2,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl 95% (CAS 4482-03-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111025-5g |
| cas | 4482-03-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 3084.88 Pln | |
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 726.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111025 |
1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene (CAS 4482-03-5) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene. InChIKey: CWPWAQJHDDRCKP-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene |
| InChIKey | CWPWAQJHDDRCKP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)