cas: 4482-03-5 — see every product listed under this CAS number, including other names
2,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl, 95%, 95% (CAS 4482-03-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D8N-100mg |
| cas | 4482-03-5 |
| size | 100mg |
| availability | 1.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 602.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene (CAS 4482-03-5) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene. InChIKey: CWPWAQJHDDRCKP-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene |
| InChIKey | CWPWAQJHDDRCKP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)