cas: 6582-52-1 — see every product listed under this CAS number, including other names
2,2'-Methylenedianiline 95% (CAS 6582-52-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A875278-100mg |
| cas | 6582-52-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 2445.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A875278 |
2-[(2-aminophenyl)methyl]aniline (CAS 6582-52-1) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 2-[(2-aminophenyl)methyl]aniline. InChIKey: OHKOAJUTRVTYSW-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2-[(2-aminophenyl)methyl]aniline |
| InChIKey | OHKOAJUTRVTYSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=CC=CC=C2N)N |
Computed by PubChem (NCBI)