CAS 61057-85-0 appears in our catalog under these names: 2-(Amino-phenyl-methyl)-phenylamine, 95%, alpha–(2–Aminophenyl)benzylamine, 2-Amino-α-phenylbenzenemethanamine, >95%, >95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-[amino(phenyl)methyl]aniline (CAS 61057-85-0) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 2-[amino(phenyl)methyl]aniline. InChIKey: SJCSSVLZFASSLN-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2-[amino(phenyl)methyl]aniline |
| InChIKey | SJCSSVLZFASSLN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2N)N |
Computed by PubChem (NCBI)