CAS 6318-71-4 is the registry number for [4-(2-Pyridin-2-ylethyl)phenyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(2-pyridin-2-ylethyl)aniline (CAS 6318-71-4) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 4-(2-pyridin-2-ylethyl)aniline. InChIKey: JLXIKRWYUBIXPX-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 4-(2-pyridin-2-ylethyl)aniline |
| InChIKey | JLXIKRWYUBIXPX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CCC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)