cas: 169295-54-9 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(4-Methoxy-naphthalen-1-yl)-ethanone (CAS 169295-54-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608510-100MG |
| cas | 169295-54-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 1101.71 Pln | |
| Fluorochem | 1g | 2923.99 Pln |
| delivery time | 3-4 weeks |
|---|
2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanone (CAS 169295-54-9) is a chemical compound with the molecular formula C13H9F3O2 and a molecular weight of 254.20 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanone. InChIKey: QDUIAIPDAPNCBE-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O2 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanone |
| InChIKey | QDUIAIPDAPNCBE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=CC=CC=C21)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)