CAS 173025-79-1 appears in our catalog under these names: 4-(4-Trifluoromethoxyphenyl)phenol, 98%, 4'-(Trifluoromethoxy)-[1,1'-biphenyl]-4-ol 98%, 4-(4-Trifluoromethoxyphenyl)phenol, 98%, 98%, 4-(4-Trifluoromethoxyphenyl)phenol. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
4-[4-(trifluoromethoxy)phenyl]phenol (CAS 173025-79-1) is a chemical compound with the molecular formula C13H9F3O2 and a molecular weight of 254.20 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenyl]phenol. InChIKey: BQHPTVCTYWEKJL-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O2 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenyl]phenol |
| InChIKey | BQHPTVCTYWEKJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)OC(F)(F)F)O |
Computed by PubChem (NCBI)