CAS 169295-54-9 appears in our catalog under these names: 2,2,2-Trifluoro-1-(4-methoxy-naphthalen-1-yl)-ethanone, 95%, 2,2,2–Trifluoro–1–(4–Methoxy–naphthalen–1–yl)–ethanone, 2,2,2-Trifluoro-1-(4-Methoxy-naphthalen-1-yl)-ethanone. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanone (CAS 169295-54-9) is a chemical compound with the molecular formula C13H9F3O2 and a molecular weight of 254.20 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanone. InChIKey: QDUIAIPDAPNCBE-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O2 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethanone |
| InChIKey | QDUIAIPDAPNCBE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=CC=CC=C21)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)