cas: 852443-99-3 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(4-fluorophenyl)ethanamine 96% (CAS 852443-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A235559-100mg |
| cas | 852443-99-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1666.44 Pln | |
| Ambeed | 5g | 4914.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A235559 |
2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine (CAS 852443-99-3) is a chemical compound with the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine. InChIKey: FRDAKAYQSQLWRW-UHFFFAOYSA-N.
| Molecular formula | C8H7F4N |
|---|---|
| Molecular weight | 193.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine |
| InChIKey | FRDAKAYQSQLWRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)F |
Computed by PubChem (NCBI)