cas: 42452-42-6 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-2'-(trifluoromethyl)acetophenone, 95% (CAS 42452-42-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633791-250MG |
| cas | 42452-42-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 500mg | 351.98 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 1346.42 Pln | |
| Fluorochem | 10g | 2632.42 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethanone (CAS 42452-42-6) is a chemical compound with the molecular formula C9H4F6O and a molecular weight of 242.12 g/mol. IUPAC name: 2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethanone. InChIKey: VPQVFSPSGIQSCW-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethanone |
| InChIKey | VPQVFSPSGIQSCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)