Products 118762-55-3
CAS 118762-55-3 appears in our catalog under these names: 2,6-Bis(trifluoromethyl)benzaldehyde 95%, 2,6-Bis(trifluoromethyl)benzaldehyde, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-bis(trifluoromethyl)benzaldehyde (CAS 118762-55-3) is a chemical compound with the molecular formula C9H4F6O and a molecular weight of 242.12 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)benzaldehyde. InChIKey: RHHRPFMCPJVSQZ-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 2,6-bis(trifluoromethyl)benzaldehyde |
| InChIKey | RHHRPFMCPJVSQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)C=O)C(F)(F)F |
Computed by PubChem (NCBI)