cas: 434-45-7 — see every product listed under this CAS number, including other names
2,2,2-Trifluoroacetophenone 98% (CAS 434-45-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A603592-5g |
| cas | 434-45-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 626.25 Pln | |
| Ambeed | 500g | 2350.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A603592 |
2,2,2-trifluoro-1-phenylethanone (CAS 434-45-7) is a chemical compound with the molecular formula C8H5F3O and a molecular weight of 174.12 g/mol. IUPAC name: 2,2,2-trifluoro-1-phenylethanone. InChIKey: KZJRKRQSDZGHEC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O |
|---|---|
| Molecular weight | 174.12 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-phenylethanone |
| InChIKey | KZJRKRQSDZGHEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)