cas: 154445-78-0 — see every product listed under this CAS number, including other names
2,2,4,6,7-Pentamethyl-2,3-dihydrobenzofuran-5-sulfonyl chloride (CAS 154445-78-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212890-250MG |
| cas | 154445-78-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 372.80 Pln | |
| Fluorochem | 25g | 721.64 Pln |
| delivery time | 2-3 weeks |
|---|
2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride (CAS 154445-78-0) is a chemical compound with the molecular formula C13H17ClO3S and a molecular weight of 288.79 g/mol. IUPAC name: 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride. InChIKey: HLJKUZUILACRPQ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO3S |
|---|---|
| Molecular weight | 288.79 g/mol |
| IUPAC name | 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride |
| InChIKey | HLJKUZUILACRPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)