cas: 154445-78-0 — see every product listed under this CAS number, including other names
Pbf-Cl 88% (CAS 154445-78-0) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217740-500g |
| cas | 154445-78-0 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 8658.50 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 264.69 Pln | |
| Ambeed | 10g | 403.75 Pln | |
| Ambeed | 25g | 743.06 Pln | |
| Ambeed | 100g | 2217.12 Pln |
| purity | 88% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217740 |
2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride (CAS 154445-78-0) is a chemical compound with the molecular formula C13H17ClO3S and a molecular weight of 288.79 g/mol. IUPAC name: 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride. InChIKey: HLJKUZUILACRPQ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO3S |
|---|---|
| Molecular weight | 288.79 g/mol |
| IUPAC name | 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride |
| InChIKey | HLJKUZUILACRPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)